C25H29NO5 — CID 59939575
(1R,2S,6S,16S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid (PubChem CID 59939575) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (1R,2S,6S,16S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid.
| Compound Name | (1R,2S,6S,16S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid |
|---|---|
| PubChem CID | 59939575 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (1R,2S,6S,16S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carboxylic acid |
| SMILES | COc1ccc2c3c1OC1C4(OC)C=C[C@@]5(C[C@@H]4C(=O)O)[C@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C25H29NO5/c1-29-17-6-5-15-11-18-23-7-8-25(30-2,16(12-23)21(27)28)22-24(23,19(15)20(17)31-22)9-10-26(18)13-14-3-4-14/h5-8,14,16,18,22H,3-4,9-13H2,1-2H3,(H,27,28)/t16-,18+,22?,23-,24+,25?/m1/s1 |
| InChIKey | ZASWTDPSDAIBTH-KKCGVUOQSA-N |
| XLogP | 2.78 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|