C32H36N2O5 — CID 59939565
benzyl N-[(1R,2S,6S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]carbamate (PubChem CID 59939565) has the molecular formula C32H36N2O5 and a molecular weight of 528.65 g/mol. Its IUPAC name is benzyl N-[(1R,2S,6S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]carbamate.
| Compound Name | benzyl N-[(1R,2S,6S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]carbamate |
|---|---|
| PubChem CID | 59939565 |
| Molecular Formula | C32H36N2O5 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | benzyl N-[(1R,2S,6S)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]carbamate |
| SMILES | COc1ccc2c3c1OC1C4(OC)C=C[C@@]5(CC4NC(=O)OCc4ccccc4)[C@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C32H36N2O5/c1-36-23-11-10-22-16-25-30-12-13-32(37-2,24(17-30)33-29(35)38-19-21-6-4-3-5-7-21)28-31(30,26(22)27(23)39-28)14-15-34(25)18-20-8-9-20/h3-7,10-13,20,24-25,28H,8-9,14-19H2,1-2H3,(H,33,35)/t24?,25-,28?,30+,31-,32?/m0/s1 |
| InChIKey | IIUYWGZXPNEUIE-QVVNZHLHSA-N |
| XLogP | 4.37 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|