C33H38N2O4 — CID 91225552
N-[(1R,2S,6R,15R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-3-phenylpropanamide (PubChem CID 91225552) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is N-[(1R,2S,6R,15R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-3-phenylpropanamide.
| Compound Name | N-[(1R,2S,6R,15R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 91225552 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | N-[(1R,2S,6R,15R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-3-phenylpropanamide |
| SMILES | COc1ccc2c3c1OC1[C@@]4(OC)C=C[C@@]5(CC4NC(=O)CCc4ccccc4)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C33H38N2O4/c1-37-24-12-11-23-18-26-31-14-15-33(38-2,25(19-31)34-27(36)13-10-21-6-4-3-5-7-21)30-32(31,28(23)29(24)39-30)16-17-35(26)20-22-8-9-22/h3-7,11-12,14-15,22,25-26,30H,8-10,13,16-20H2,1-2H3,(H,34,36)/t25?,26-,30?,31-,32+,33-/m1/s1 |
| InChIKey | HAEIUKWWNYHOIP-CRHAHICFSA-N |
| XLogP | 4.20 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|