C40H44N2O5 — CID 90208154
benzyl 2-[[[(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethyl]amino]acetate (PubChem CID 90208154) has the molecular formula C40H44N2O5 and a molecular weight of 632.80 g/mol. Its IUPAC name is benzyl 2-[[[(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethyl]amino]acetate.
| Compound Name | benzyl 2-[[[(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethyl]amino]acetate |
|---|---|
| PubChem CID | 90208154 |
| Molecular Formula | C40H44N2O5 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.33 |
| IUPAC Name | benzyl 2-[[[(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethyl]amino]acetate |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@]4(OC)C=C[C@@]5(C[C@@H]4C(NCC(=O)OCc4ccccc4)c4ccccc4)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C40H44N2O5/c1-44-31-16-15-29-21-32-38-17-18-40(45-2,37-39(38,34(29)36(31)47-37)19-20-42(32)24-26-13-14-26)30(22-38)35(28-11-7-4-8-12-28)41-23-33(43)46-25-27-9-5-3-6-10-27/h3-12,15-18,26,30,32,35,37,41H,13-14,19-25H2,1-2H3/t30-,32-,35?,37-,38-,39+,40-/m1/s1 |
| InChIKey | SZNANFJZONZFQQ-NRFLKFFESA-N |
| XLogP | 5.77 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|