C31H35NO3 — CID 90207327
[(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanol (PubChem CID 90207327) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is [(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanol.
| Compound Name | [(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanol |
|---|---|
| PubChem CID | 90207327 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | [(1R,2S,6R,14R,15R,16R)-5-(cyclopropylmethyl)-15-methoxy-11-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]-phenylmethanol |
| SMILES | CO[C@]12C=C[C@@]3(C[C@@H]1C(O)c1ccccc1)[C@H]1Cc4ccc(C)c5c4[C@@]3(CCN1CC1CC1)[C@H]2O5 |
| InChI | InChI=1S/C31H35NO3/c1-19-8-11-22-16-24-29-12-13-31(34-2,23(17-29)26(33)21-6-4-3-5-7-21)28-30(29,25(22)27(19)35-28)14-15-32(24)18-20-9-10-20/h3-8,11-13,20,23-24,26,28,33H,9-10,14-18H2,1-2H3/t23-,24-,26?,28-,29-,30+,31-/m1/s1 |
| InChIKey | LRYAFLRZNDEBRA-KQAZURPDSA-N |
| XLogP | 4.73 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|