C27H31NO5 — CID 90799428
[19-acetyl-5-(cyclopropylmethyl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-yl] acetate (PubChem CID 90799428) has the molecular formula C27H31NO5 and a molecular weight of 449.55 g/mol. Its IUPAC name is [19-acetyl-5-(cyclopropylmethyl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-yl] acetate.
| Compound Name | [19-acetyl-5-(cyclopropylmethyl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-yl] acetate |
|---|---|
| PubChem CID | 90799428 |
| Molecular Formula | C27H31NO5 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [19-acetyl-5-(cyclopropylmethyl)-15-methoxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-yl] acetate |
| SMILES | COC12C=CC3(CC1C(C)=O)C1Cc4ccc(OC(C)=O)c5c4C3(CCN1CC1CC1)C2O5 |
| InChI | InChI=1S/C27H31NO5/c1-15(29)19-13-25-8-9-27(19,31-3)24-26(25)10-11-28(14-17-4-5-17)21(25)12-18-6-7-20(32-16(2)30)23(33-24)22(18)26/h6-9,17,19,21,24H,4-5,10-14H2,1-3H3 |
| InChIKey | KXQLLJRPKWHSGP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|