C30H32N2O6 — CID 59808623
benzyl (1S,2R,6R,14R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13,16-dioxa-5,17-diazahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-17-carboxylate (PubChem CID 59808623) has the molecular formula C30H32N2O6 and a molecular weight of 516.59 g/mol. Its IUPAC name is benzyl (1S,2R,6R,14R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13,16-dioxa-5,17-diazahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-17-carboxylate.
| Compound Name | benzyl (1S,2R,6R,14R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13,16-dioxa-5,17-diazahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-17-carboxylate |
|---|---|
| PubChem CID | 59808623 |
| Molecular Formula | C30H32N2O6 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | benzyl (1S,2R,6R,14R)-5-(cyclopropylmethyl)-11,15-dimethoxy-13,16-dioxa-5,17-diazahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-17-carboxylate |
| SMILES | COc1ccc2c3c1O[C@H]1C4(OC)C=C[C@]5([C@@H](C2)N(CC2CC2)CC[C@]315)N(C(=O)OCc1ccccc1)O4 |
| InChI | InChI=1S/C30H32N2O6/c1-34-22-11-10-21-16-23-29-12-13-30(35-2,38-32(29)27(33)36-18-20-6-4-3-5-7-20)26-28(29,24(21)25(22)37-26)14-15-31(23)17-19-8-9-19/h3-7,10-13,19,23,26H,8-9,14-18H2,1-2H3/t23-,26-,28+,29-,30?/m1/s1 |
| InChIKey | PINPWMAKSSPMLZ-RXVIRFCYSA-N |
| XLogP | 3.97 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|