C30H34N2O5 — CID 90384803
(1R,2S,6R)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-11-methoxy-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide (PubChem CID 90384803) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is (1R,2S,6R)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-11-methoxy-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide.
| Compound Name | (1R,2S,6R)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-11-methoxy-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide |
|---|---|
| PubChem CID | 90384803 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (1R,2S,6R)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-11-methoxy-13,17-dioxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide |
| SMILES | COc1ccc2c3c1OC1C4(O)CC[C@]5(OC4C(=O)NCc4ccccc4)[C@@H](C2)N(CC2CC2)CC[C@]315 |
| InChI | InChI=1S/C30H34N2O5/c1-35-21-10-9-20-15-22-30-12-11-29(34,25(37-30)26(33)31-16-18-5-3-2-4-6-18)27-28(30,23(20)24(21)36-27)13-14-32(22)17-19-7-8-19/h2-6,9-10,19,22,25,27,34H,7-8,11-17H2,1H3,(H,31,33)/t22-,25?,27?,28+,29?,30+/m1/s1 |
| InChIKey | JHSLBMUEPFUYCX-QHZZUBBSSA-N |
| XLogP | 2.71 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |