C30H34N2O3 — CID 90384693
(2S,6R,15R,16S)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide (PubChem CID 90384693) has the molecular formula C30H34N2O3 and a molecular weight of 470.61 g/mol. Its IUPAC name is (2S,6R,15R,16S)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide.
| Compound Name | (2S,6R,15R,16S)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide |
|---|---|
| PubChem CID | 90384693 |
| Molecular Formula | C30H34N2O3 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | (2S,6R,15R,16S)-N-benzyl-5-(cyclopropylmethyl)-15-hydroxy-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11-triene-16-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@H]1CC23CC[C@]1(O)C1Oc4cccc5c4[C@@]12CCN(CC1CC1)[C@@H]3C5 |
| InChI | InChI=1S/C30H34N2O3/c33-26(31-17-19-5-2-1-3-6-19)22-16-28-11-12-30(22,34)27-29(28)13-14-32(18-20-9-10-20)24(28)15-21-7-4-8-23(35-27)25(21)29/h1-8,20,22,24,27,34H,9-18H2,(H,31,33)/t22-,24-,27?,28?,29+,30-/m1/s1 |
| InChIKey | ZODDMMKOJABHHI-IKDYZFJRSA-N |
| XLogP | 3.57 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |