C30H34N2O5 — CID 163671708
(2'R)-N-benzyl-3-cyclobutyl-4a-hydroxy-9-methoxyspiro[2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,3'-oxirane]-2'-carboxamide (PubChem CID 163671708) has the molecular formula C30H34N2O5 and a molecular weight of 502.61 g/mol. Its IUPAC name is (2'R)-N-benzyl-3-cyclobutyl-4a-hydroxy-9-methoxyspiro[2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,3'-oxirane]-2'-carboxamide.
| Compound Name | (2'R)-N-benzyl-3-cyclobutyl-4a-hydroxy-9-methoxyspiro[2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,3'-oxirane]-2'-carboxamide |
|---|---|
| PubChem CID | 163671708 |
| Molecular Formula | C30H34N2O5 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.25 |
| IUPAC Name | (2'R)-N-benzyl-3-cyclobutyl-4a-hydroxy-9-methoxyspiro[2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7,3'-oxirane]-2'-carboxamide |
| SMILES | COc1ccc2c3c1OC1C4(CCC5(O)C(C2)N(C2CCC2)CCC315)O[C@H]4C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C30H34N2O5/c1-35-21-11-10-19-16-22-30(34)13-12-29(25(37-29)26(33)31-17-18-6-3-2-4-7-18)27-28(30,23(19)24(21)36-27)14-15-32(22)20-8-5-9-20/h2-4,6-7,10-11,20,22,25,27,34H,5,8-9,12-17H2,1H3,(H,31,33)/t22?,25-,27?,28?,29?,30?/m0/s1 |
| InChIKey | JDCXAWKXTAYAJA-SRZKNQLCSA-N |
| XLogP | 2.86 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|