C30H33N3O6 — CID 139216392
(1R,2S,6R,14S,15R,16R)-11,15-dimethoxy-N'-(4-methoxybenzoyl)-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbohydrazide (PubChem CID 139216392) has the molecular formula C30H33N3O6 and a molecular weight of 531.61 g/mol. Its IUPAC name is (1R,2S,6R,14S,15R,16R)-11,15-dimethoxy-N'-(4-methoxybenzoyl)-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbohydrazide.
| Compound Name | (1R,2S,6R,14S,15R,16R)-11,15-dimethoxy-N'-(4-methoxybenzoyl)-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbohydrazide |
|---|---|
| PubChem CID | 139216392 |
| Molecular Formula | C30H33N3O6 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | (1R,2S,6R,14S,15R,16R)-11,15-dimethoxy-N'-(4-methoxybenzoyl)-5-methyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraene-16-carbohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)[C@@H]2C[C@@]34C=C[C@]2(OC)[C@H]2Oc5c(OC)ccc6c5[C@@]23CCN(C)[C@@H]4C6)cc1 |
| InChI | InChI=1S/C30H33N3O6/c1-33-14-13-29-23-18-7-10-21(37-3)24(23)39-27(29)30(38-4)12-11-28(29,22(33)15-18)16-20(30)26(35)32-31-25(34)17-5-8-19(36-2)9-6-17/h5-12,20,22,27H,13-16H2,1-4H3,(H,31,34)(H,32,35)/t20-,22+,27-,28+,29-,30+/m0/s1 |
| InChIKey | KNSBYRLPDYSYCM-ZUILQLBVSA-N |
| XLogP | 2.39 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|