C24H31NO5 — CID 135158155
(4'S,12'bR)-9'-methoxy-3'-(3-methylbut-2-enyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol (PubChem CID 135158155) has the molecular formula C24H31NO5 and a molecular weight of 413.51 g/mol. Its IUPAC name is (4'S,12'bR)-9'-methoxy-3'-(3-methylbut-2-enyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol.
| Compound Name | (4'S,12'bR)-9'-methoxy-3'-(3-methylbut-2-enyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
|---|---|
| PubChem CID | 135158155 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (4'S,12'bR)-9'-methoxy-3'-(3-methylbut-2-enyl)spiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
| SMILES | COc1ccc2c3c1OC1C4(CCC5(O)[C@H](C2)N(CC=C(C)C)CC[C@@]315)OCCO4 |
| InChI | InChI=1S/C24H31NO5/c1-15(2)6-10-25-11-9-22-19-16-4-5-17(27-3)20(19)30-21(22)24(28-12-13-29-24)8-7-23(22,26)18(25)14-16/h4-6,18,21,26H,7-14H2,1-3H3/t18-,21?,22+,23?/m0/s1 |
| InChIKey | BNZXAVJKEOGTCN-CCKJBCASSA-N |
| XLogP | 2.56 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|