C23H29NO7S — CID 58049293
[(1'S,14'R)-2'-hydroxy-15'-prop-2-enylspiro[1,3-dioxolane-2,5'-7-oxa-15-azapentacyclo[10.6.1.01,6.02,14.08,19]nonadeca-8,10,12(19)-triene]-9'-yl] methanesulfonate (PubChem CID 58049293) has the molecular formula C23H29NO7S and a molecular weight of 463.55 g/mol. Its IUPAC name is [(1'S,14'R)-2'-hydroxy-15'-prop-2-enylspiro[1,3-dioxolane-2,5'-7-oxa-15-azapentacyclo[10.6.1.01,6.02,14.08,19]nonadeca-8,10,12(19)-triene]-9'-yl] methanesulfonate.
| Compound Name | [(1'S,14'R)-2'-hydroxy-15'-prop-2-enylspiro[1,3-dioxolane-2,5'-7-oxa-15-azapentacyclo[10.6.1.01,6.02,14.08,19]nonadeca-8,10,12(19)-triene]-9'-yl] methanesulfonate |
|---|---|
| PubChem CID | 58049293 |
| Molecular Formula | C23H29NO7S |
| Molecular Weight | 463.55 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | [(1'S,14'R)-2'-hydroxy-15'-prop-2-enylspiro[1,3-dioxolane-2,5'-7-oxa-15-azapentacyclo[10.6.1.01,6.02,14.08,19]nonadeca-8,10,12(19)-triene]-9'-yl] methanesulfonate |
| SMILES | C=CCN1CCC[C@]23c4c5ccc(OS(C)(=O)=O)c4OC2C2(CCC3(O)[C@H]1C5)OCCO2 |
| InChI | InChI=1S/C23H29NO7S/c1-3-10-24-11-4-7-21-18-15-5-6-16(31-32(2,26)27)19(18)30-20(21)23(28-12-13-29-23)9-8-22(21,25)17(24)14-15/h3,5-6,17,20,25H,1,4,7-14H2,2H3/t17-,20?,21+,22?/m1/s1 |
| InChIKey | FDLZLNCIOBULCF-FOXKFOACSA-N |
| XLogP | 1.50 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.55 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|