C28H33NO7 — CID 70505195
[(4'R,12'bS)-3'-(cyclobutanecarbonyl)-4'a-hydroxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-9'-yl] cyclobutanecarboxylate (PubChem CID 70505195) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is [(4'R,12'bS)-3'-(cyclobutanecarbonyl)-4'a-hydroxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-9'-yl] cyclobutanecarboxylate.
| Compound Name | [(4'R,12'bS)-3'-(cyclobutanecarbonyl)-4'a-hydroxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-9'-yl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 70505195 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | [(4'R,12'bS)-3'-(cyclobutanecarbonyl)-4'a-hydroxyspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-9'-yl] cyclobutanecarboxylate |
| SMILES | O=C(Oc1ccc2c3c1OC1C4(CCC5(O)[C@@H](C2)N(C(=O)C2CCC2)CC[C@]315)OCCO4)C1CCC1 |
| InChI | InChI=1S/C28H33NO7/c30-23(16-3-1-4-16)29-12-11-26-21-18-7-8-19(35-24(31)17-5-2-6-17)22(21)36-25(26)28(33-13-14-34-28)10-9-27(26,32)20(29)15-18/h7-8,16-17,20,25,32H,1-6,9-15H2/t20-,25?,26+,27?/m1/s1 |
| InChIKey | OVTPKKZMNBNKSM-BLHNXMMRSA-N |
| XLogP | 2.62 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|