C25H26N2O9S — CID 135314490
(4'R,4'aS,7'aR,12'bS)-9'-methoxy-3'-(2-nitrophenyl)sulfonylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol (PubChem CID 135314490) has the molecular formula C25H26N2O9S and a molecular weight of 530.56 g/mol. Its IUPAC name is (4'R,4'aS,7'aR,12'bS)-9'-methoxy-3'-(2-nitrophenyl)sulfonylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol.
| Compound Name | (4'R,4'aS,7'aR,12'bS)-9'-methoxy-3'-(2-nitrophenyl)sulfonylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
|---|---|
| PubChem CID | 135314490 |
| Molecular Formula | C25H26N2O9S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.14 |
| IUPAC Name | (4'R,4'aS,7'aR,12'bS)-9'-methoxy-3'-(2-nitrophenyl)sulfonylspiro[1,3-dioxolane-2,7'-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline]-4'a-ol |
| SMILES | COc1ccc2c3c1O[C@H]1C4(CC[C@@]5(O)[C@@H](C2)N(S(=O)(=O)c2ccccc2[N+](=O)[O-])CC[C@]315)OCCO4 |
| InChI | InChI=1S/C25H26N2O9S/c1-33-17-7-6-15-14-19-24(28)8-9-25(34-12-13-35-25)22-23(24,20(15)21(17)36-22)10-11-26(19)37(31,32)18-5-3-2-4-16(18)27(29)30/h2-7,19,22,28H,8-14H2,1H3/t19-,22-,23+,24-/m1/s1 |
| InChIKey | CAJZNNKEDNNELH-OUJCMCIWSA-N |
| XLogP | 1.89 |
| TPSA | 137.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|