C24H27NO5 — CID 70552676
(4R,4aS,7aR,12bR)-4a-acetyl-3-(cyclobutanecarbonyl)-9-methoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 70552676) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is (4R,4aS,7aR,12bR)-4a-acetyl-3-(cyclobutanecarbonyl)-9-methoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4R,4aS,7aR,12bR)-4a-acetyl-3-(cyclobutanecarbonyl)-9-methoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 70552676 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | (4R,4aS,7aR,12bR)-4a-acetyl-3-(cyclobutanecarbonyl)-9-methoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CC[C@@]4(C(C)=O)[C@@H](C2)N(C(=O)C2CCC2)CC[C@]314 |
| InChI | InChI=1S/C24H27NO5/c1-13(26)23-9-8-16(27)21-24(23)10-11-25(22(28)14-4-3-5-14)18(23)12-15-6-7-17(29-2)20(30-21)19(15)24/h6-7,14,18,21H,3-5,8-12H2,1-2H3/t18-,21+,23-,24+/m1/s1 |
| InChIKey | XTRIELUUMDOKKF-LJAMWKNPSA-N |
| XLogP | 2.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |