C19H21NO4 — CID 126538939
(4S,4aS,7aS)-3-acetyl-9-methoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one (PubChem CID 126538939) has the molecular formula C19H21NO4 and a molecular weight of 327.38 g/mol. Its IUPAC name is (4S,4aS,7aS)-3-acetyl-9-methoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one.
| Compound Name | (4S,4aS,7aS)-3-acetyl-9-methoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
|---|---|
| PubChem CID | 126538939 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | (4S,4aS,7aS)-3-acetyl-9-methoxy-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one |
| SMILES | COc1ccc2c3c1O[C@@H]1C(=O)CC[C@@H]4[C@H](C2)N(C(C)=O)CCC314 |
| InChI | InChI=1S/C19H21NO4/c1-10(21)20-8-7-19-12-4-5-14(22)18(19)24-17-15(23-2)6-3-11(16(17)19)9-13(12)20/h3,6,12-13,18H,4-5,7-9H2,1-2H3/t12-,13+,18-,19?/m1/s1 |
| InChIKey | CVNLBNUJPHXXDX-JFVVOQOHSA-N |
| XLogP | 1.85 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |