C18H20O3 — CID 134301591
(5R,13R)-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one (PubChem CID 134301591) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is (5R,13R)-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one.
| Compound Name | (5R,13R)-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one |
|---|---|
| PubChem CID | 134301591 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (5R,13R)-10-methoxy-12-oxapentacyclo[9.6.1.01,13.05,17.07,18]octadeca-7(18),8,10-trien-14-one |
| SMILES | COc1ccc2c3c1O[C@H]1C(=O)CCC4[C@H](CCCC341)C2 |
| InChI | InChI=1S/C18H20O3/c1-20-14-7-4-11-9-10-3-2-8-18-12(10)5-6-13(19)17(18)21-16(14)15(11)18/h4,7,10,12,17H,2-3,5-6,8-9H2,1H3/t10-,12?,17+,18?/m1/s1 |
| InChIKey | MIADWWFEAUDUOO-NWMBUASVSA-N |
| XLogP | 3.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |