C19H24NO3+ — CID 50917445
(4R,4aS,12bS)-9-methoxy-3,3-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 50917445) has the molecular formula C19H24NO3+ and a molecular weight of 314.40 g/mol. Its IUPAC name is (4R,4aS,12bS)-9-methoxy-3,3-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (4R,4aS,12bS)-9-methoxy-3,3-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 50917445 |
| Molecular Formula | C19H24NO3+ |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | (4R,4aS,12bS)-9-methoxy-3,3-dimethyl-1,2,4,4a,5,6,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | COc1ccc2c3c1OC1C(=O)CC[C@@H]4[C@@H](C2)[N+](C)(C)CC[C@]314 |
| InChI | InChI=1S/C19H24NO3/c1-20(2)9-8-19-12-5-6-14(21)18(19)23-17-15(22-3)7-4-11(16(17)19)10-13(12)20/h4,7,12-13,18H,5-6,8-10H2,1-3H3/q+1/t12-,13-,18?,19+/m1/s1 |
| InChIKey | NIKRKQGOFAMULR-HMTQMRNMSA-N |
| XLogP | 2.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|