C19H26INO3 — CID 76965957
(4R,4aR,7R,7aR,12bS)-9-methoxy-3,3-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol iodide (PubChem CID 76965957) has the molecular formula C19H26INO3 and a molecular weight of 443.33 g/mol. Its IUPAC name is (4R,4aR,7R,7aR,12bS)-9-methoxy-3,3-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol iodide.
| Compound Name | (4R,4aR,7R,7aR,12bS)-9-methoxy-3,3-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol iodide |
|---|---|
| PubChem CID | 76965957 |
| Molecular Formula | C19H26INO3 |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | (4R,4aR,7R,7aR,12bS)-9-methoxy-3,3-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-ol iodide |
| SMILES | COc1ccc2c3c1O[C@H]1[C@H](O)CC[C@H]4[C@@H](C2)[N+](C)(C)CC[C@@]341.[I-] |
| InChI | InChI=1S/C19H26NO3.HI/c1-20(2)9-8-19-12-5-6-14(21)18(19)23-17-15(22-3)7-4-11(16(17)19)10-13(12)20;/h4,7,12-14,18,21H,5-6,8-10H2,1-3H3;1H/q+1;/p-1/t12-,13+,14+,18-,19-;/m0./s1 |
| InChIKey | DOSDTIQSAHMBQC-PURXAMKGSA-M |
| XLogP | -1.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|