C18H26NO7P — CID 71316147
CID 71316147 (PubChem CID 71316147) has the molecular formula C18H26NO7P and a molecular weight of 399.38 g/mol.
| Compound Name | CID 71316147 |
|---|---|
| PubChem CID | 71316147 |
| Molecular Formula | C18H26NO7P |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | — |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](O)CC[C@H]4[C@H](C2)N(C)CC[C@@]341.O=P(=O)OO.[H][H] |
| InChI | InChI=1S/C18H23NO3.HO4P.H2/c1-19-8-7-18-11-4-5-13(20)17(18)22-16-14(21-2)6-3-10(15(16)18)9-12(11)19;1-4-5(2)3;/h3,6,11-13,17,20H,4-5,7-9H2,1-2H3;1H;1H/t11-,12-,13-,17-,18-;;/m0../s1 |
| InChIKey | SPEPHQCUUFDHQK-WUJOFNDPSA-N |
| XLogP | 2.54 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|