C18H21NO5 — CID 58571244
(7-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) hydrogen carbonate (PubChem CID 58571244) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is (7-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) hydrogen carbonate.
| Compound Name | (7-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 58571244 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | (7-hydroxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-9-yl) hydrogen carbonate |
| SMILES | CN1CCC23c4c5ccc(OC(=O)O)c4OC2C(O)CCC3C1C5 |
| InChI | InChI=1S/C18H21NO5/c1-19-7-6-18-10-3-4-12(20)16(18)24-15-13(23-17(21)22)5-2-9(14(15)18)8-11(10)19/h2,5,10-12,16,20H,3-4,6-8H2,1H3,(H,21,22) |
| InChIKey | PUEZMCICLNKIPD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|