C20H27NO3 — CID 134526072
(2R,5S,6S)-6-(cyclopropylmethylamino)-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol (PubChem CID 134526072) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (2R,5S,6S)-6-(cyclopropylmethylamino)-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol.
| Compound Name | (2R,5S,6S)-6-(cyclopropylmethylamino)-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol |
|---|---|
| PubChem CID | 134526072 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2R,5S,6S)-6-(cyclopropylmethylamino)-11-methoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-8(13),9,11-trien-2-ol |
| SMILES | COc1ccc2c3c1OC1[C@H](O)CC[C@H]([C@@H](NCC4CC4)C2)C31C |
| InChI | InChI=1S/C20H27NO3/c1-20-13-6-7-15(22)19(20)24-18-16(23-2)8-5-12(17(18)20)9-14(13)21-10-11-3-4-11/h5,8,11,13-15,19,21-22H,3-4,6-7,9-10H2,1-2H3/t13-,14+,15-,19?,20?/m1/s1 |
| InChIKey | DMCRWQLGKRMYJY-HMPNUMLOSA-N |
| XLogP | 2.41 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |