C20H28N2O3 — CID 126538600
2-[[(4S,4aS,7aS,12bR)-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]ethanol (PubChem CID 126538600) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-[[(4S,4aS,7aS,12bR)-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]ethanol.
| Compound Name | 2-[[(4S,4aS,7aS,12bR)-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]ethanol |
|---|---|
| PubChem CID | 126538600 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | 2-[[(4S,4aS,7aS,12bR)-9-methoxy-3-methyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]amino]ethanol |
| SMILES | COc1ccc2c3c1O[C@@H]1C(NCCO)CC[C@@H]4[C@H](C2)N(C)CC[C@@]314 |
| InChI | InChI=1S/C20H28N2O3/c1-22-9-7-20-13-4-5-14(21-8-10-23)19(20)25-18-16(24-2)6-3-12(17(18)20)11-15(13)22/h3,6,13-15,19,21,23H,4-5,7-11H2,1-2H3/t13-,14?,15+,19-,20-/m1/s1 |
| InChIKey | ZVUBYCZOYQGHHM-QYBZDMLFSA-N |
| XLogP | 1.31 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |