C20H27NO3 — CID 163835156
(4R,6R,7S,7aR,12bS)-7,9-dimethoxy-3,6-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline (PubChem CID 163835156) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is (4R,6R,7S,7aR,12bS)-7,9-dimethoxy-3,6-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline.
| Compound Name | (4R,6R,7S,7aR,12bS)-7,9-dimethoxy-3,6-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
|---|---|
| PubChem CID | 163835156 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (4R,6R,7S,7aR,12bS)-7,9-dimethoxy-3,6-dimethyl-2,4,4a,5,6,7,7a,13-octahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline |
| SMILES | COc1ccc2c3c1O[C@H]1[C@@H](OC)[C@H](C)CC4[C@@H](C2)N(C)CC[C@@]341 |
| InChI | InChI=1S/C20H27NO3/c1-11-9-13-14-10-12-5-6-15(22-3)18-16(12)20(13,7-8-21(14)2)19(24-18)17(11)23-4/h5-6,11,13-14,17,19H,7-10H2,1-4H3/t11-,13?,14-,17+,19+,20+/m1/s1 |
| InChIKey | OHCBAFYFTDSPLV-AFBFRBFLSA-N |
| XLogP | 2.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |