C22H27NO3 — CID 134526196
(6S,14R)-N-(cyclobutylmethyl)-2,11-dimethoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,4,8(13),9,11-pentaen-6-amine (PubChem CID 134526196) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is (6S,14R)-N-(cyclobutylmethyl)-2,11-dimethoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,4,8(13),9,11-pentaen-6-amine.
| Compound Name | (6S,14R)-N-(cyclobutylmethyl)-2,11-dimethoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,4,8(13),9,11-pentaen-6-amine |
|---|---|
| PubChem CID | 134526196 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (6S,14R)-N-(cyclobutylmethyl)-2,11-dimethoxy-14-methyl-15-oxatetracyclo[10.2.1.05,14.08,13]pentadeca-2,4,8(13),9,11-pentaen-6-amine |
| SMILES | COC1=CC=C2[C@@H](NCC3CCC3)Cc3ccc(OC)c4c3[C@]2(C)C1O4 |
| InChI | InChI=1S/C22H27NO3/c1-22-15-8-10-18(25-3)21(22)26-20-17(24-2)9-7-14(19(20)22)11-16(15)23-12-13-5-4-6-13/h7-10,13,16,21,23H,4-6,11-12H2,1-3H3/t16-,21?,22+/m0/s1 |
| InChIKey | MJQCYVQPJJZQAY-GWGYHSHPSA-N |
| XLogP | 3.50 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |