C23H28BrNO3 — CID 56958293
(3S,4R,7aR,12bS)-3-(cyclobutylmethyl)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol bromide (PubChem CID 56958293) has the molecular formula C23H28BrNO3 and a molecular weight of 446.39 g/mol. Its IUPAC name is (3S,4R,7aR,12bS)-3-(cyclobutylmethyl)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol bromide.
| Compound Name | (3S,4R,7aR,12bS)-3-(cyclobutylmethyl)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol bromide |
|---|---|
| PubChem CID | 56958293 |
| Molecular Formula | C23H28BrNO3 |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | (3S,4R,7aR,12bS)-3-(cyclobutylmethyl)-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol bromide |
| SMILES | COC1=CC=C2[C@H]3Cc4ccc(O)c5c4[C@@]2(CC[N@@+]3(C)CC2CCC2)[C@H]1O5.[Br-] |
| InChI | InChI=1S/C23H27NO3.BrH/c1-24(13-14-4-3-5-14)11-10-23-16-7-9-19(26-2)22(23)27-21-18(25)8-6-15(20(21)23)12-17(16)24;/h6-9,14,17,22H,3-5,10-13H2,1-2H3;1H/t17-,22+,23+,24+;/m1./s1 |
| InChIKey | FTTLWCYSYBUCBV-KQXAEMHWSA-N |
| XLogP | 0.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|