C22H29NO6 — CID 169427260
(3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,5,6,9-tetrahydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;carbanide (PubChem CID 169427260) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is (3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,5,6,9-tetrahydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;carbanide.
| Compound Name | (3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,5,6,9-tetrahydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;carbanide |
|---|---|
| PubChem CID | 169427260 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,5,6,9-tetrahydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;carbanide |
| SMILES | C[N@+]1(CC2CC2)CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)C(O)C(O)[C@@]3(O)[C@H]1C5.[CH3-] |
| InChI | InChI=1S/C21H25NO6.CH3/c1-22(9-10-2-3-10)7-6-20-14-11-4-5-12(23)17(14)28-19(20)16(25)15(24)18(26)21(20,27)13(22)8-11;/h4-5,10,13,15,18-19,24,26-27H,2-3,6-9H2,1H3;1H3/q;-1/p+1/t13-,15?,18?,19+,20+,21+,22-;/m1./s1 |
| InChIKey | LXGKETQFADICKP-GBTBGBEWSA-O |
| XLogP | 0.06 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|