C21H28NO4+ — CID 58380494
(4aS,12bS)-3-(cyclopropylmethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol (PubChem CID 58380494) has the molecular formula C21H28NO4+ and a molecular weight of 358.46 g/mol. Its IUPAC name is (4aS,12bS)-3-(cyclopropylmethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol.
| Compound Name | (4aS,12bS)-3-(cyclopropylmethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol |
|---|---|
| PubChem CID | 58380494 |
| Molecular Formula | C21H28NO4+ |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.20 |
| IUPAC Name | (4aS,12bS)-3-(cyclopropylmethyl)-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol |
| SMILES | C[N+]1(CC2CC2)CC[C@]23c4c5ccc(O)c4OC2C(O)CC[C@@]3(O)C1C5 |
| InChI | InChI=1S/C21H27NO4/c1-22(11-12-2-3-12)9-8-20-17-13-4-5-14(23)18(17)26-19(20)15(24)6-7-21(20,25)16(22)10-13/h4-5,12,15-16,19,24-25H,2-3,6-11H2,1H3/p+1/t15?,16?,19?,20-,21+,22?/m0/s1 |
| InChIKey | ZDECYIARZVKYGM-PJJYBPIJSA-O |
| XLogP | 1.46 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|