C24H30F3NO6 — CID 68806057
(4R,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol;2,2,2-trifluoroacetate (PubChem CID 68806057) has the molecular formula C24H30F3NO6 and a molecular weight of 485.50 g/mol. Its IUPAC name is (4R,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol;2,2,2-trifluoroacetate.
| Compound Name | (4R,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 68806057 |
| Molecular Formula | C24H30F3NO6 |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | (4R,7S,7aR,12bS)-3-(cyclopropylmethyl)-7-methoxy-3-methyl-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol;2,2,2-trifluoroacetate |
| SMILES | CO[C@H]1CCC2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CC[N+]3(C)CC2CC2)[C@H]1O5.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C22H29NO4.C2HF3O2/c1-23(12-13-3-4-13)10-9-21-18-14-5-6-15(24)19(18)27-20(21)16(26-2)7-8-22(21,25)17(23)11-14;3-2(4,5)1(6)7/h5-6,13,16-17,20,25H,3-4,7-12H2,1-2H3;(H,6,7)/t16-,17+,20-,21-,22?,23?;/m0./s1 |
| InChIKey | NGKYJVGNIJDFEO-QVRKYMQXSA-N |
| XLogP | 1.41 |
| TPSA | 99.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|