C23H30INO4 — CID 68958135
(3R,4R,7aR,12bS)-3-(cyclopentylmethyl)-4a,9-dihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide (PubChem CID 68958135) has the molecular formula C23H30INO4 and a molecular weight of 511.40 g/mol. Its IUPAC name is (3R,4R,7aR,12bS)-3-(cyclopentylmethyl)-4a,9-dihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide.
| Compound Name | (3R,4R,7aR,12bS)-3-(cyclopentylmethyl)-4a,9-dihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
|---|---|
| PubChem CID | 68958135 |
| Molecular Formula | C23H30INO4 |
| Molecular Weight | 511.40 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | (3R,4R,7aR,12bS)-3-(cyclopentylmethyl)-4a,9-dihydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
| SMILES | C[N@+]1(CC2CCCC2)CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)CCC3(O)[C@H]1C5.[I-] |
| InChI | InChI=1S/C23H29NO4.HI/c1-24(13-14-4-2-3-5-14)11-10-22-19-15-6-7-16(25)20(19)28-21(22)17(26)8-9-23(22,27)18(24)12-15;/h6-7,14,18,21,27H,2-5,8-13H2,1H3;1H/t18-,21+,22+,23?,24-;/m1./s1 |
| InChIKey | ZOJXBJXOVMKCNJ-PAILVRTJSA-N |
| XLogP | -0.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.40 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|