C24H32INO3 — CID 68812613
(4R,4aS,7aS,12bR)-3-(cyclopentylmethyl)-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol iodide (PubChem CID 68812613) has the molecular formula C24H32INO3 and a molecular weight of 509.43 g/mol. Its IUPAC name is (4R,4aS,7aS,12bR)-3-(cyclopentylmethyl)-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol iodide.
| Compound Name | (4R,4aS,7aS,12bR)-3-(cyclopentylmethyl)-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol iodide |
|---|---|
| PubChem CID | 68812613 |
| Molecular Formula | C24H32INO3 |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | (4R,4aS,7aS,12bR)-3-(cyclopentylmethyl)-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol iodide |
| SMILES | C=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@]2(CC[N+]3(C)CC2CCCC2)[C@H]1O5.[I-] |
| InChI | InChI=1S/C24H31NO3.HI/c1-15-9-10-24(27)19-13-17-7-8-18(26)21-20(17)23(24,22(15)28-21)11-12-25(19,2)14-16-5-3-4-6-16;/h7-8,16,19,22,27H,1,3-6,9-14H2,2H3;1H/t19-,22+,23-,24-,25?;/m1./s1 |
| InChIKey | MZYLBOZXQMWBOE-BCENHZCMSA-N |
| XLogP | 0.44 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|