C26H34INO4 — CID 158241227
[(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide (PubChem CID 158241227) has the molecular formula C26H34INO4 and a molecular weight of 551.47 g/mol. Its IUPAC name is [(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide.
| Compound Name | [(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide |
|---|---|
| PubChem CID | 158241227 |
| Molecular Formula | C26H34INO4 |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | [(4R,4aS,7aS,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-methylidene-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide |
| SMILES | C=C1CC[C@@]2(O)[C@H]3Cc4ccc(OC(=O)C(C)C)c5c4[C@@]2(CC[N+]3(C)CC2CC2)[C@H]1O5.[I-] |
| InChI | InChI=1S/C26H34NO4.HI/c1-15(2)24(28)30-19-8-7-18-13-20-26(29)10-9-16(3)23-25(26,21(18)22(19)31-23)11-12-27(20,4)14-17-5-6-17;/h7-8,15,17,20,23,29H,3,5-6,9-14H2,1-2,4H3;1H/q+1;/p-1/t20-,23+,25+,26-,27?;/m1./s1 |
| InChIKey | LJBVPEXEYHJSBD-VLMBJNDASA-M |
| XLogP | 0.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|