C24H30INO5 — CID 157269168
[(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide (PubChem CID 157269168) has the molecular formula C24H30INO5 and a molecular weight of 539.41 g/mol. Its IUPAC name is [(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide.
| Compound Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide |
|---|---|
| PubChem CID | 157269168 |
| Molecular Formula | C24H30INO5 |
| Molecular Weight | 539.41 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | [(4R,4aS,7aR,12bS)-4a-hydroxy-3-methyl-7-oxo-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-yl] 2-methylpropanoate iodide |
| SMILES | C=CC[N+]1(C)CC[C@]23c4c5ccc(OC(=O)C(C)C)c4O[C@H]2C(=O)CC[C@@]3(O)[C@H]1C5.[I-] |
| InChI | InChI=1S/C24H30NO5.HI/c1-5-11-25(4)12-10-23-19-15-6-7-17(29-22(27)14(2)3)20(19)30-21(23)16(26)8-9-24(23,28)18(25)13-15;/h5-7,14,18,21,28H,1,8-13H2,2-4H3;1H/q+1;/p-1/t18-,21+,23+,24-,25?;/m1./s1 |
| InChIKey | ILIWCQBYCROCOX-LLYGCPBESA-M |
| XLogP | -0.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.41 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|