C21H24NO5+ — CID 169443698
(3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-6,7-dione (PubChem CID 169443698) has the molecular formula C21H24NO5+ and a molecular weight of 370.43 g/mol. Its IUPAC name is (3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-6,7-dione.
| Compound Name | (3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-6,7-dione |
|---|---|
| PubChem CID | 169443698 |
| Molecular Formula | C21H24NO5+ |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | (3R,4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-methyl-1,2,4,5,7a,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-6,7-dione |
| SMILES | C[N@+]1(CC2CC2)CC[C@]23c4c5ccc(O)c4O[C@H]2C(=O)C(=O)C[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C21H23NO5/c1-22(10-11-2-3-11)7-6-20-16-12-4-5-13(23)18(16)27-19(20)17(25)14(24)9-21(20,26)15(22)8-12/h4-5,11,15,19,26H,2-3,6-10H2,1H3/p+1/t15-,19+,20+,21-,22-/m1/s1 |
| InChIKey | KRQKCPYXUDVUPX-MPRQEMDOSA-O |
| XLogP | 0.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|