C22H28NO4+ — CID 58380420
(3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3,5-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 58380420) has the molecular formula C22H28NO4+ and a molecular weight of 370.47 g/mol. Its IUPAC name is (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3,5-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3,5-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 58380420 |
| Molecular Formula | C22H28NO4+ |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (3R,4S,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3,5-dimethyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | CC1CC(=O)[C@@H]2Oc3c(O)ccc4c3[C@@]23CC[N@+](C)(CC2CC2)[C@@H](C4)[C@]13O |
| InChI | InChI=1S/C22H27NO4/c1-12-9-16(25)20-21-7-8-23(2,11-13-3-4-13)17(22(12,21)26)10-14-5-6-15(24)19(27-20)18(14)21/h5-6,12-13,17,20,26H,3-4,7-11H2,1-2H3/p+1/t12?,17-,20-,21-,22+,23+/m0/s1 |
| InChIKey | MDKIOCVQUOUEKK-HMZWOQFBSA-O |
| XLogP | 1.92 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|