C20H23NO5 — CID 50917268
(3R,4R,4aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 50917268) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (3R,4R,4aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3R,4R,4aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 50917268 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (3R,4R,4aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | O=C1CC[C@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CC[N@@+]3([O-])CC2CC2)C1O5 |
| InChI | InChI=1S/C20H23NO5/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)26-18)7-8-21(15,25)10-11-1-2-11/h3-4,11,15,18,22,24H,1-2,5-10H2/t15-,18?,19+,20+,21-/m1/s1 |
| InChIKey | JJAGFDOKJICYTI-KIQZURCQSA-N |
| XLogP | 1.54 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|