C21H21F6NO7 — CID 42623077
(4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-oxido-3-(3,3,3-trifluoropropyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;2,2,2-trifluoroacetic acid (PubChem CID 42623077) has the molecular formula C21H21F6NO7 and a molecular weight of 513.39 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-oxido-3-(3,3,3-trifluoropropyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-oxido-3-(3,3,3-trifluoropropyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 42623077 |
| Molecular Formula | C21H21F6NO7 |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-oxido-3-(3,3,3-trifluoropropyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4[C@@]2(CC[N+]3([O-])CCC(F)(F)F)[C@H]1O5 |
| InChI | InChI=1S/C19H20F3NO5.C2HF3O2/c20-19(21,22)6-8-23(27)7-5-17-14-10-1-2-11(24)15(14)28-16(17)12(25)3-4-18(17,26)13(23)9-10;3-2(4,5)1(6)7/h1-2,13,16,24,26H,3-9H2;(H,6,7)/t13-,16+,17+,18-,23?;/m1./s1 |
| InChIKey | CNJBHXMYMQSZIF-WOJRVXDVSA-N |
| XLogP | 2.71 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|