C28H31NO5 — CID 140529386
(4R,4aS,7aR,12bS)-3-(2-cyclopropylethyl)-9-hydroxy-3-oxido-4a-phenylmethoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 140529386) has the molecular formula C28H31NO5 and a molecular weight of 461.56 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-3-(2-cyclopropylethyl)-9-hydroxy-3-oxido-4a-phenylmethoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (4R,4aS,7aR,12bS)-3-(2-cyclopropylethyl)-9-hydroxy-3-oxido-4a-phenylmethoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 140529386 |
| Molecular Formula | C28H31NO5 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.22 |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(2-cyclopropylethyl)-9-hydroxy-3-oxido-4a-phenylmethoxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | O=C1CC[C@@]2(OCc3ccccc3)[C@H]3Cc4ccc(O)c5c4[C@@]2(CC[N+]3([O-])CCC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C28H31NO5/c30-21-9-8-20-16-23-28(33-17-19-4-2-1-3-5-19)12-10-22(31)26-27(28,24(20)25(21)34-26)13-15-29(23,32)14-11-18-6-7-18/h1-5,8-9,18,23,26,30H,6-7,10-17H2/t23-,26+,27+,28-,29?/m1/s1 |
| InChIKey | AAYFNGAKGXRNTC-YFXAWBRNSA-N |
| XLogP | 4.15 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|