C26H30INO4 — CID 10460149
(3S,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-3-(2-phenylethyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide (PubChem CID 10460149) has the molecular formula C26H30INO4 and a molecular weight of 547.43 g/mol. Its IUPAC name is (3S,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-3-(2-phenylethyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide.
| Compound Name | (3S,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-3-(2-phenylethyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
|---|---|
| PubChem CID | 10460149 |
| Molecular Formula | C26H30INO4 |
| Molecular Weight | 547.43 g/mol |
| Exact Mass | 547.12 |
| IUPAC Name | (3S,4aS,12bS)-9-hydroxy-4a-methoxy-3-methyl-3-(2-phenylethyl)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one iodide |
| SMILES | CO[C@@]12CCC(=O)C3Oc4c(O)ccc5c4[C@@]31CC[N@+](C)(CCc1ccccc1)C2C5.[I-] |
| InChI | InChI=1S/C26H29NO4.HI/c1-27(14-11-17-6-4-3-5-7-17)15-13-25-22-18-8-9-19(28)23(22)31-24(25)20(29)10-12-26(25,30-2)21(27)16-18;/h3-9,21,24H,10-16H2,1-2H3;1H/t21?,24?,25-,26+,27-;/m0./s1 |
| InChIKey | NXXBKWHGHDMPQK-UIAUXZOHSA-N |
| XLogP | 0.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.43 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|