C31H38NO4+ — CID 10394028
(3R,4aS,12bS)-3-(cyclopropylmethyl)-9-methoxy-3-methyl-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 10394028) has the molecular formula C31H38NO4+ and a molecular weight of 488.65 g/mol. Its IUPAC name is (3R,4aS,12bS)-3-(cyclopropylmethyl)-9-methoxy-3-methyl-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3R,4aS,12bS)-3-(cyclopropylmethyl)-9-methoxy-3-methyl-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 10394028 |
| Molecular Formula | C31H38NO4+ |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (3R,4aS,12bS)-3-(cyclopropylmethyl)-9-methoxy-3-methyl-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | COc1ccc2c3c1OC1C(=O)CC[C@@]4(OCCCc5ccccc5)C(C2)[N@@+](C)(CC2CC2)CC[C@]314 |
| InChI | InChI=1S/C31H38NO4/c1-32(20-22-10-11-22)17-16-30-27-23-12-13-25(34-2)28(27)36-29(30)24(33)14-15-31(30,26(32)19-23)35-18-6-9-21-7-4-3-5-8-21/h3-5,7-8,12-13,22,26,29H,6,9-11,14-20H2,1-2H3/q+1/t26?,29?,30-,31+,32+/m0/s1 |
| InChIKey | CJAYNSSSWQHHQB-NFQKPHEPSA-N |
| XLogP | 4.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|