C33H39NO5 — CID 159707520
(4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-3-oxido-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;but-2-yne (PubChem CID 159707520) has the molecular formula C33H39NO5 and a molecular weight of 529.68 g/mol. Its IUPAC name is (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-3-oxido-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;but-2-yne.
| Compound Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-3-oxido-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;but-2-yne |
|---|---|
| PubChem CID | 159707520 |
| Molecular Formula | C33H39NO5 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.28 |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-9-hydroxy-3-oxido-4a-(3-phenylpropoxy)-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one;but-2-yne |
| SMILES | CC#CC.O=C1CC[C@@]2(OCCCc3ccccc3)[C@H]3Cc4ccc(O)c5c4[C@@]2(CC[N+]3([O-])CC2CC2)[C@H]1O5 |
| InChI | InChI=1S/C29H33NO5.C4H6/c31-22-11-10-21-17-24-29(34-16-4-7-19-5-2-1-3-6-19)13-12-23(32)27-28(29,25(21)26(22)35-27)14-15-30(24,33)18-20-8-9-20;1-3-4-2/h1-3,5-6,10-11,20,24,27,31H,4,7-9,12-18H2;1-2H3/t24-,27+,28+,29-,30?;/m1./s1 |
| InChIKey | MYKHTRFMOCJLRS-ZILFPIQPSA-N |
| XLogP | 5.22 |
| TPSA | 78.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|