C28H31ClNO4+ — CID 10326363
(3R,4aS,12bS)-4a-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one (PubChem CID 10326363) has the molecular formula C28H31ClNO4+ and a molecular weight of 481.01 g/mol. Its IUPAC name is (3R,4aS,12bS)-4a-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one.
| Compound Name | (3R,4aS,12bS)-4a-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
|---|---|
| PubChem CID | 10326363 |
| Molecular Formula | C28H31ClNO4+ |
| Molecular Weight | 481.01 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | (3R,4aS,12bS)-4a-[(4-chlorophenyl)methoxy]-3-(cyclopropylmethyl)-9-hydroxy-3-methyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-one |
| SMILES | C[N@+]1(CC2CC2)CC[C@]23c4c5ccc(O)c4OC2C(=O)CC[C@@]3(OCc2ccc(Cl)cc2)C1C5 |
| InChI | InChI=1S/C28H30ClNO4/c1-30(15-17-2-3-17)13-12-27-24-19-6-9-21(31)25(24)34-26(27)22(32)10-11-28(27,23(30)14-19)33-16-18-4-7-20(29)8-5-18/h4-9,17,23,26H,2-3,10-16H2,1H3/p+1/t23?,26?,27-,28+,30+/m0/s1 |
| InChIKey | CUDVCRDJIPURLG-YRSRKSAPSA-O |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.01 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|