C21H27NO5 — CID 87581870
(4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(hydroxymethyl)-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol (PubChem CID 87581870) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is (4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(hydroxymethyl)-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol.
| Compound Name | (4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(hydroxymethyl)-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol |
|---|---|
| PubChem CID | 87581870 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | (4R,4aS,12bS)-3-(cyclopropylmethyl)-7-(hydroxymethyl)-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,9-diol |
| SMILES | [O-][N+]1(CC2CC2)CC[C@]23c4c5ccc(O)c4OC2C(CO)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C21H27NO5/c23-11-14-5-6-21(25)16-9-13-3-4-15(24)18-17(13)20(21,19(14)27-18)7-8-22(16,26)10-12-1-2-12/h3-4,12,14,16,19,23-25H,1-2,5-11H2/t14?,16-,19?,20+,21-,22?/m1/s1 |
| InChIKey | VOVQWFJHRNWIBC-OONHDUBZSA-N |
| XLogP | 1.58 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|