C20H26NO5+ — CID 58111575
(4S,4aR,7R,7aS,12bR)-3-(cyclopropylmethyl)-3-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol (PubChem CID 58111575) has the molecular formula C20H26NO5+ and a molecular weight of 360.43 g/mol. Its IUPAC name is (4S,4aR,7R,7aS,12bR)-3-(cyclopropylmethyl)-3-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol.
| Compound Name | (4S,4aR,7R,7aS,12bR)-3-(cyclopropylmethyl)-3-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol |
|---|---|
| PubChem CID | 58111575 |
| Molecular Formula | C20H26NO5+ |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (4S,4aR,7R,7aS,12bR)-3-(cyclopropylmethyl)-3-hydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-4a,7,9-triol |
| SMILES | Oc1ccc2c3c1O[C@@H]1[C@H](O)CC[C@]4(O)[C@H](C2)[N+](O)(CC2CC2)CC[C@@]314 |
| InChI | InChI=1S/C20H25NO5/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)26-18)7-8-21(15,25)10-11-1-2-11/h3-4,11,14-15,18,23-25H,1-2,5-10H2/p+1/t14-,15+,18-,19-,20+,21?/m1/s1 |
| InChIKey | WGPUHEXZXRRWMA-WBVWKGEUSA-O |
| XLogP | 1.22 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|