C27H30N2O5 — CID 44608564
N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]benzamide (PubChem CID 44608564) has the molecular formula C27H30N2O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]benzamide.
| Compound Name | N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]benzamide |
|---|---|
| PubChem CID | 44608564 |
| Molecular Formula | C27H30N2O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]benzamide |
| SMILES | O=C(N[C@@H]1CC[C@@]2(O)[C@H]3Cc4ccc(O)c5c4C2(CC[N+]3([O-])CC2CC2)[C@H]1O5)c1ccccc1 |
| InChI | InChI=1S/C27H30N2O5/c30-20-9-8-18-14-21-27(32)11-10-19(28-25(31)17-4-2-1-3-5-17)24-26(27,22(18)23(20)34-24)12-13-29(21,33)15-16-6-7-16/h1-5,8-9,16,19,21,24,30,32H,6-7,10-15H2,(H,28,31)/t19-,21-,24+,26?,27-,29?/m1/s1 |
| InChIKey | SWPXILYAMROOFY-SRNIJROMSA-N |
| XLogP | 2.77 |
| TPSA | 101.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|