C27H31N3O4 — CID 86580874
(4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-(pyridine-4-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-olate (PubChem CID 86580874) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-(pyridine-4-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-olate.
| Compound Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-(pyridine-4-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-olate |
|---|---|
| PubChem CID | 86580874 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (4R,4aS,7R,7aR,12bS)-3-(cyclopropylmethyl)-4a-hydroxy-3-methyl-7-(pyridine-4-carbonylamino)-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-olate |
| SMILES | C[N+]1(CC2CC2)CC[C@]23c4c5ccc([O-])c4O[C@H]2[C@H](NC(=O)c2ccncc2)CC[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C27H31N3O4/c1-30(15-16-2-3-16)13-10-26-22-18-4-5-20(31)23(22)34-24(26)19(6-9-27(26,33)21(30)14-18)29-25(32)17-7-11-28-12-8-17/h4-5,7-8,11-12,16,19,21,24,33H,2-3,6,9-10,13-15H2,1H3,(H-,29,31,32)/t19-,21-,24+,26+,27-,30?/m1/s1 |
| InChIKey | QTKRNRCJBHQSGX-DBTFWVQASA-N |
| XLogP | 1.66 |
| TPSA | 94.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|