C28H32N2O7S — CID 44609213
N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]-4-methylsulfonylbenzamide (PubChem CID 44609213) has the molecular formula C28H32N2O7S and a molecular weight of 540.64 g/mol. Its IUPAC name is N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]-4-methylsulfonylbenzamide.
| Compound Name | N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 44609213 |
| Molecular Formula | C28H32N2O7S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | N-[(4R,4aS,7R,7aR)-3-(cyclopropylmethyl)-4a,9-dihydroxy-3-oxido-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-7-yl]-4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)N[C@@H]2CC[C@@]3(O)[C@H]4Cc5ccc(O)c6c5C3(CC[N+]4([O-])CC3CC3)[C@H]2O6)cc1 |
| InChI | InChI=1S/C28H32N2O7S/c1-38(35,36)19-7-4-17(5-8-19)26(32)29-20-10-11-28(33)22-14-18-6-9-21(31)24-23(18)27(28,25(20)37-24)12-13-30(22,34)15-16-2-3-16/h4-9,16,20,22,25,31,33H,2-3,10-15H2,1H3,(H,29,32)/t20-,22-,25+,27?,28-,30?/m1/s1 |
| InChIKey | DKFVQNLXDQBIKW-AHKDYBLYSA-N |
| XLogP | 2.17 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|