C22H24NO3+ — CID 154793120
3-but-3-ynyl-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol (PubChem CID 154793120) has the molecular formula C22H24NO3+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 3-but-3-ynyl-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol.
| Compound Name | 3-but-3-ynyl-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol |
|---|---|
| PubChem CID | 154793120 |
| Molecular Formula | C22H24NO3+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 3-but-3-ynyl-7-methoxy-3-methyl-2,4,7a,13-tetrahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-3-ium-9-ol |
| SMILES | C#CCC[N+]1(C)CCC23C4=CC=C(OC)C2Oc2c(O)ccc(c23)CC41 |
| InChI | InChI=1S/C22H23NO3/c1-4-5-11-23(2)12-10-22-15-7-9-18(25-3)21(22)26-20-17(24)8-6-14(19(20)22)13-16(15)23/h1,6-9,16,21H,5,10-13H2,2-3H3/p+1 |
| InChIKey | WPTLLISMMGPESA-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|