C18H19NO3 — CID 123276784
9-methoxy-4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-6,8,12,14,16-pentaen-13-ol (PubChem CID 123276784) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is 9-methoxy-4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-6,8,12,14,16-pentaen-13-ol.
| Compound Name | 9-methoxy-4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-6,8,12,14,16-pentaen-13-ol |
|---|---|
| PubChem CID | 123276784 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 9-methoxy-4,5-dimethyl-11-oxa-4-azapentacyclo[8.7.0.01,6.03,16.012,17]heptadeca-6,8,12,14,16-pentaen-13-ol |
| SMILES | COC1=CC=C2C(C)N(C)C3CC24c2c3ccc(O)c2OC14 |
| InChI | InChI=1S/C18H19NO3/c1-9-11-5-7-14(21-3)17-18(11)8-12(19(9)2)10-4-6-13(20)16(22-17)15(10)18/h4-7,9,12,17,20H,8H2,1-3H3 |
| InChIKey | VKTPMCPOMPCGMQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |